C6H9F3N4O3S2 — CID 19978576
3-amino-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol;trifluoromethanesulfonic acid (PubChem CID 19978576) has the molecular formula C6H9F3N4O3S2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 3-amino-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol;trifluoromethanesulfonic acid.
| Compound Name | 3-amino-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 19978576 |
| Molecular Formula | C6H9F3N4O3S2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3-amino-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol;trifluoromethanesulfonic acid |
| SMILES | Nc1nnc2n1CC(S)C2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C5H8N4S.CHF3O3S/c6-5-8-7-4-1-3(10)2-9(4)5;2-1(3,4)8(5,6)7/h3,10H,1-2H2,(H2,6,8);(H,5,6,7) |
| InChIKey | KIUMVBPSEVNYQD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|