C6H8F3N3O3S2 — CID 19978586
6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-7-thiol;trifluoromethanesulfonic acid (PubChem CID 19978586) has the molecular formula C6H8F3N3O3S2 and a molecular weight of 291.28 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-7-thiol;trifluoromethanesulfonic acid.
| Compound Name | 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-7-thiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 19978586 |
| Molecular Formula | C6H8F3N3O3S2 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-7-thiol;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.SC1CCn2cnnc21 |
| InChI | InChI=1S/C5H7N3S.CHF3O3S/c9-4-1-2-8-3-6-7-5(4)8;2-1(3,4)8(5,6)7/h3-4,9H,1-2H2;(H,5,6,7) |
| InChIKey | MGPITUDBQYTPIM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|