About 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid
3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid (PubChem CID 19978808) has the molecular formula C20H12Cl2F4O4
and a molecular weight of 463.21 g/mol. Its IUPAC name is 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid |
| PubChem CID | 19978808 |
| Molecular Formula | C20H12Cl2F4O4 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid |
| SMILES | O=C(O)CCOc1ccc2cc(Oc3c(Cl)cc(C(F)(F)F)c(F)c3Cl)ccc2c1 |
| InChI | InChI=1S/C20H12Cl2F4O4/c21-15-9-14(20(24,25)26)18(23)17(22)19(15)30-13-4-2-10-7-12(3-1-11(10)8-13)29-6-5-16(27)28/h1-4,7-9H,5-6H2,(H,27,28) |
| InChIKey | QGYIMILRBBMRCE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid?
The IUPAC name of 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid (CID 19978808) is 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid.
What is the SMILES notation for 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid?
The canonical SMILES for 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid is O=C(O)CCOc1ccc2cc(Oc3c(Cl)cc(C(F)(F)F)c(F)c3Cl)ccc2c1.
What is the InChIKey of 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid?
The InChIKey is QGYIMILRBBMRCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl2F4O4/c21-15-9-14(20(24,25)26)18(23)17(22)19(15)30-13-4-2-10-7-12(3-1-11(10)8-13)29-6-5-16(27)28/h1-4,7-9H,5-6H2,(H,27,28).
What are the key properties of 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid?
3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid has a molecular weight of 463.21 g/mol, XLogP of 6.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid is sourced from PubChem (CID 19978808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).