2-(1,3-thiazol-2-yl)benzoic acid

C10H7NO2S — CID 19979384

IUPAC2-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1nccs1
InChIInChI=1S/C10H7NO2S/c12-10(13)8-4-2-1-3-7(8)9-11-5-6-14-9/h1-6H,(H,12,13)
InChIKeyFQRCVHZNITWETI-UHFFFAOYSA-N
MW205.24 g/mol
LogP2.51
Rot. Bonds2

About 2-(1,3-thiazol-2-yl)benzoic acid

2-(1,3-thiazol-2-yl)benzoic acid (PubChem CID 19979384) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name2-(1,3-thiazol-2-yl)benzoic acid
PubChem CID19979384
Molecular FormulaC10H7NO2S
Molecular Weight205.24 g/mol
Exact Mass205.02
IUPAC Name2-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1nccs1
InChIInChI=1S/C10H7NO2S/c12-10(13)8-4-2-1-3-7(8)9-11-5-6-14-9/h1-6H,(H,12,13)
InChIKeyFQRCVHZNITWETI-UHFFFAOYSA-N
XLogP2.51
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.24
LogP ≤ 52.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,3-thiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-thiazol-2-yl)benzoic acid?
The IUPAC name of 2-(1,3-thiazol-2-yl)benzoic acid (CID 19979384) is 2-(1,3-thiazol-2-yl)benzoic acid.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)benzoic acid?
The canonical SMILES for 2-(1,3-thiazol-2-yl)benzoic acid is O=C(O)c1ccccc1-c1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)benzoic acid?
The InChIKey is FQRCVHZNITWETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2S/c12-10(13)8-4-2-1-3-7(8)9-11-5-6-14-9/h1-6H,(H,12,13).
What are the key properties of 2-(1,3-thiazol-2-yl)benzoic acid?
2-(1,3-thiazol-2-yl)benzoic acid has a molecular weight of 205.24 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)benzoic acid is sourced from PubChem (CID 19979384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).