About 5H-thieno[3,2-b]pyran-2-carbonitrile
5H-thieno[3,2-b]pyran-2-carbonitrile (PubChem CID 19979387) has the molecular formula C8H5NOS
and a molecular weight of 163.20 g/mol. Its IUPAC name is 5H-thieno[3,2-b]pyran-2-carbonitrile.
Molecular Properties
| Compound Name | 5H-thieno[3,2-b]pyran-2-carbonitrile |
| PubChem CID | 19979387 |
| Molecular Formula | C8H5NOS |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 5H-thieno[3,2-b]pyran-2-carbonitrile |
| SMILES | N#Cc1cc2c(s1)C=CCO2 |
| InChI | InChI=1S/C8H5NOS/c9-5-6-4-7-8(11-6)2-1-3-10-7/h1-2,4H,3H2 |
| InChIKey | KZHYHXXAHBVRHW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-thieno[3,2-b]pyran-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-thieno[3,2-b]pyran-2-carbonitrile?
The IUPAC name of 5H-thieno[3,2-b]pyran-2-carbonitrile (CID 19979387) is 5H-thieno[3,2-b]pyran-2-carbonitrile.
What is the SMILES notation for 5H-thieno[3,2-b]pyran-2-carbonitrile?
The canonical SMILES for 5H-thieno[3,2-b]pyran-2-carbonitrile is N#Cc1cc2c(s1)C=CCO2.
What is the InChIKey of 5H-thieno[3,2-b]pyran-2-carbonitrile?
The InChIKey is KZHYHXXAHBVRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS/c9-5-6-4-7-8(11-6)2-1-3-10-7/h1-2,4H,3H2.
What are the key properties of 5H-thieno[3,2-b]pyran-2-carbonitrile?
5H-thieno[3,2-b]pyran-2-carbonitrile has a molecular weight of 163.20 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-thieno[3,2-b]pyran-2-carbonitrile is sourced from PubChem (CID 19979387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).