C18H22F3N3OS2 — CID 19979632
methyl N'-tert-butyl-N-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]carbamimidothioate (PubChem CID 19979632) has the molecular formula C18H22F3N3OS2 and a molecular weight of 417.52 g/mol. Its IUPAC name is methyl N'-tert-butyl-N-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]carbamimidothioate.
| Compound Name | methyl N'-tert-butyl-N-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 19979632 |
| Molecular Formula | C18H22F3N3OS2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | methyl N'-tert-butyl-N-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\C(C)(C)C)Nc1c(C)cc(Oc2nc(C(F)(F)F)cs2)cc1C |
| InChI | InChI=1S/C18H22F3N3OS2/c1-10-7-12(25-16-22-13(9-27-16)18(19,20)21)8-11(2)14(10)23-15(26-6)24-17(3,4)5/h7-9H,1-6H3,(H,23,24) |
| InChIKey | AJJNVDMLVMIGHB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|