C30H41NO — CID 19979963
2-[4-[4-(4-heptoxyphenyl)phenyl]cyclohexyl]pentanenitrile (PubChem CID 19979963) has the molecular formula C30H41NO and a molecular weight of 431.66 g/mol. Its IUPAC name is 2-[4-[4-(4-heptoxyphenyl)phenyl]cyclohexyl]pentanenitrile.
| Compound Name | 2-[4-[4-(4-heptoxyphenyl)phenyl]cyclohexyl]pentanenitrile |
|---|---|
| PubChem CID | 19979963 |
| Molecular Formula | C30H41NO |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | 2-[4-[4-(4-heptoxyphenyl)phenyl]cyclohexyl]pentanenitrile |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C3CCC(C(C#N)CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H41NO/c1-3-5-6-7-8-22-32-30-20-18-27(19-21-30)26-12-10-24(11-13-26)25-14-16-28(17-15-25)29(23-31)9-4-2/h10-13,18-21,25,28-29H,3-9,14-17,22H2,1-2H3 |
| InChIKey | XYMKUWHUMXFJQT-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|