About methyl 3-sulfonylpropanoate
methyl 3-sulfonylpropanoate (PubChem CID 19980037) has the molecular formula C4H6O4S
and a molecular weight of 150.16 g/mol. Its IUPAC name is methyl 3-sulfonylpropanoate.
Molecular Properties
| Compound Name | methyl 3-sulfonylpropanoate |
| PubChem CID | 19980037 |
| Molecular Formula | C4H6O4S |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | methyl 3-sulfonylpropanoate |
| SMILES | COC(=O)CC=S(=O)=O |
| InChI | InChI=1S/C4H6O4S/c1-8-4(5)2-3-9(6)7/h3H,2H2,1H3 |
| InChIKey | NHDPQGIRDUMDLY-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-sulfonylpropanoate?
The IUPAC name of methyl 3-sulfonylpropanoate (CID 19980037) is methyl 3-sulfonylpropanoate.
What is the SMILES notation for methyl 3-sulfonylpropanoate?
The canonical SMILES for methyl 3-sulfonylpropanoate is COC(=O)CC=S(=O)=O.
What is the InChIKey of methyl 3-sulfonylpropanoate?
The InChIKey is NHDPQGIRDUMDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4S/c1-8-4(5)2-3-9(6)7/h3H,2H2,1H3.
What are the key properties of methyl 3-sulfonylpropanoate?
methyl 3-sulfonylpropanoate has a molecular weight of 150.16 g/mol, XLogP of -0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-sulfonylpropanoate is sourced from PubChem (CID 19980037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).