About 5-diazo-1H-naphthalene
5-diazo-1H-naphthalene (PubChem CID 19980090) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-diazo-1H-naphthalene.
Molecular Properties
| Compound Name | 5-diazo-1H-naphthalene |
| PubChem CID | 19980090 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 5-diazo-1H-naphthalene |
| SMILES | [N-]=[N+]=C1C=CC=C2CC=CC=C21 |
| InChI | InChI=1S/C10H8N2/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-3,5-7H,4H2 |
| InChIKey | VPADNUDGUIYEEX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazo-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazo-1H-naphthalene?
The IUPAC name of 5-diazo-1H-naphthalene (CID 19980090) is 5-diazo-1H-naphthalene.
What is the SMILES notation for 5-diazo-1H-naphthalene?
The canonical SMILES for 5-diazo-1H-naphthalene is [N-]=[N+]=C1C=CC=C2CC=CC=C21.
What is the InChIKey of 5-diazo-1H-naphthalene?
The InChIKey is VPADNUDGUIYEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-3,5-7H,4H2.
What are the key properties of 5-diazo-1H-naphthalene?
5-diazo-1H-naphthalene has a molecular weight of 156.19 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazo-1H-naphthalene is sourced from PubChem (CID 19980090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).