C20H19N5O2 — CID 19980314
3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-(3-methylbut-2-enyl)imidazo[1,5-a]quinoxalin-4-one (PubChem CID 19980314) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-(3-methylbut-2-enyl)imidazo[1,5-a]quinoxalin-4-one.
| Compound Name | 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-(3-methylbut-2-enyl)imidazo[1,5-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 19980314 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-(3-methylbut-2-enyl)imidazo[1,5-a]quinoxalin-4-one |
| SMILES | CC(C)=CCn1c(=O)c2c(-c3noc(C4CC4)n3)ncn2c2ccccc21 |
| InChI | InChI=1S/C20H19N5O2/c1-12(2)9-10-24-14-5-3-4-6-15(14)25-11-21-16(17(25)20(24)26)18-22-19(27-23-18)13-7-8-13/h3-6,9,11,13H,7-8,10H2,1-2H3 |
| InChIKey | IETASYDEJUGIOE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|