C27H27F3N4O4 — CID 19980473
3-O-ethyl 5-O-methyl 2-(3-azido-3-phenylpropyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19980473) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-(3-azido-3-phenylpropyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-(3-azido-3-phenylpropyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19980473 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-(3-azido-3-phenylpropyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CCC(N=[N+]=[N-])c2ccccc2)NC(C)=C(C(=O)OC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H27F3N4O4/c1-4-38-26(36)24-21(15-14-20(33-34-31)17-10-6-5-7-11-17)32-16(2)22(25(35)37-3)23(24)18-12-8-9-13-19(18)27(28,29)30/h5-13,20,23,32H,4,14-15H2,1-3H3 |
| InChIKey | CVVKSXNVOAEOJI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|