About 1-amino-1,2,4-triazole-3-carboxylic acid
1-amino-1,2,4-triazole-3-carboxylic acid (PubChem CID 19980654) has the molecular formula C3H4N4O2
and a molecular weight of 128.09 g/mol. Its IUPAC name is 1-amino-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-amino-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 19980654 |
| Molecular Formula | C3H4N4O2 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 1-amino-1,2,4-triazole-3-carboxylic acid |
| SMILES | Nn1cnc(C(=O)O)n1 |
| InChI | InChI=1S/C3H4N4O2/c4-7-1-5-2(6-7)3(8)9/h1H,4H2,(H,8,9) |
| InChIKey | GWWJHQADLZHJFV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-amino-1,2,4-triazole-3-carboxylic acid (CID 19980654) is 1-amino-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-amino-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-amino-1,2,4-triazole-3-carboxylic acid is Nn1cnc(C(=O)O)n1.
What is the InChIKey of 1-amino-1,2,4-triazole-3-carboxylic acid?
The InChIKey is GWWJHQADLZHJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O2/c4-7-1-5-2(6-7)3(8)9/h1H,4H2,(H,8,9).
What are the key properties of 1-amino-1,2,4-triazole-3-carboxylic acid?
1-amino-1,2,4-triazole-3-carboxylic acid has a molecular weight of 128.09 g/mol, XLogP of -1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 19980654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).