C13H21F2NSi2 — CID 19980941
1-[(2,4-difluorophenyl)methyl]-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 19980941) has the molecular formula C13H21F2NSi2 and a molecular weight of 285.49 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 19980941 |
| Molecular Formula | C13H21F2NSi2 |
| Molecular Weight | 285.49 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H21F2NSi2/c1-17(2)7-8-18(3,4)16(17)10-11-5-6-12(14)9-13(11)15/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | MTJYDMLGNKLNJR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|