About 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde
4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde (PubChem CID 19981020) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde.
Molecular Properties
| Compound Name | 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde |
| PubChem CID | 19981020 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde |
| SMILES | CN(C)c1ccc(C=O)cc1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O.C9H11NO/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-10(2)9-5-3-8(7-11)4-6-9/h1-10H;3-7H,1-2H3 |
| InChIKey | SSYDITYVJVBGLQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde?
The IUPAC name of 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde (CID 19981020) is 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde.
What is the SMILES notation for 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde?
The canonical SMILES for 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde is CN(C)c1ccc(C=O)cc1.O=Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde?
The InChIKey is SSYDITYVJVBGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C9H11NO/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-10(2)9-5-3-8(7-11)4-6-9/h1-10H;3-7H,1-2H3.
What are the key properties of 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde?
4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde has a molecular weight of 331.42 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)benzaldehyde;4-phenylbenzaldehyde is sourced from PubChem (CID 19981020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).