About 3H-2-benzofuran-1-one;phenoxybenzene
3H-2-benzofuran-1-one;phenoxybenzene (PubChem CID 19981145) has the molecular formula C20H16O3
and a molecular weight of 304.35 g/mol. Its IUPAC name is 3H-2-benzofuran-1-one;phenoxybenzene.
Molecular Properties
| Compound Name | 3H-2-benzofuran-1-one;phenoxybenzene |
| PubChem CID | 19981145 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3H-2-benzofuran-1-one;phenoxybenzene |
| SMILES | O=C1OCc2ccccc21.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C8H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;9-8-7-4-2-1-3-6(7)5-10-8/h1-10H;1-4H,5H2 |
| InChIKey | NGDBDQFXNPAFJD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-2-benzofuran-1-one;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-2-benzofuran-1-one;phenoxybenzene?
The IUPAC name of 3H-2-benzofuran-1-one;phenoxybenzene (CID 19981145) is 3H-2-benzofuran-1-one;phenoxybenzene.
What is the SMILES notation for 3H-2-benzofuran-1-one;phenoxybenzene?
The canonical SMILES for 3H-2-benzofuran-1-one;phenoxybenzene is O=C1OCc2ccccc21.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 3H-2-benzofuran-1-one;phenoxybenzene?
The InChIKey is NGDBDQFXNPAFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C8H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;9-8-7-4-2-1-3-6(7)5-10-8/h1-10H;1-4H,5H2.
What are the key properties of 3H-2-benzofuran-1-one;phenoxybenzene?
3H-2-benzofuran-1-one;phenoxybenzene has a molecular weight of 304.35 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-2-benzofuran-1-one;phenoxybenzene is sourced from PubChem (CID 19981145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).