About 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione
5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione (PubChem CID 19981195) has the molecular formula C15H26O6
and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione.
Molecular Properties
| Compound Name | 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione |
| PubChem CID | 19981195 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione |
| SMILES | CCCC(=O)C(O)(CO)C(O)(C(=O)CCC)C(=O)CCC |
| InChI | InChI=1S/C15H26O6/c1-4-7-11(17)14(20,10-16)15(21,12(18)8-5-2)13(19)9-6-3/h16,20-21H,4-10H2,1-3H3 |
| InChIKey | FKOHPWXMJNLOTD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione?
The IUPAC name of 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione (CID 19981195) is 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione.
What is the SMILES notation for 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione?
The canonical SMILES for 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione is CCCC(=O)C(O)(CO)C(O)(C(=O)CCC)C(=O)CCC.
What is the InChIKey of 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione?
The InChIKey is FKOHPWXMJNLOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O6/c1-4-7-11(17)14(20,10-16)15(21,12(18)8-5-2)13(19)9-6-3/h16,20-21H,4-10H2,1-3H3.
What are the key properties of 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione?
5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione has a molecular weight of 302.37 g/mol, XLogP of 0.55, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butanoyl-5,6-dihydroxy-6-(hydroxymethyl)decane-4,7-dione is sourced from PubChem (CID 19981195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).