C17H27ClO2 — CID 19981581
[(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate (PubChem CID 19981581) has the molecular formula C17H27ClO2 and a molecular weight of 298.85 g/mol. Its IUPAC name is [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate.
| Compound Name | [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate |
|---|---|
| PubChem CID | 19981581 |
| Molecular Formula | C17H27ClO2 |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate |
| SMILES | C=C(C)C(Cl)CC/C(C)=C/CC/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C17H27ClO2/c1-13(2)17(18)10-9-14(3)7-6-8-15(4)11-12-20-16(5)19/h7,11,17H,1,6,8-10,12H2,2-5H3/b14-7+,15-11+ |
| InChIKey | NHLIVYWOJAQJQY-LRDJDILRSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|