About [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate
[1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate (PubChem CID 19982155) has the molecular formula C23H25F2NO2S
and a molecular weight of 417.52 g/mol. Its IUPAC name is [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate |
| PubChem CID | 19982155 |
| Molecular Formula | C23H25F2NO2S |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate |
| SMILES | O=C(OCC1CCN(CC2CSc3ccc(F)cc3C2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25F2NO2S/c24-20-3-1-18(2-4-20)23(27)28-14-16-7-9-26(10-8-16)13-17-11-19-12-21(25)5-6-22(19)29-15-17/h1-6,12,16-17H,7-11,13-15H2 |
| InChIKey | UQOKRMXMNMGFBS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate?
The IUPAC name of [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate (CID 19982155) is [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate.
What is the SMILES notation for [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate?
The canonical SMILES for [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate is O=C(OCC1CCN(CC2CSc3ccc(F)cc3C2)CC1)c1ccc(F)cc1.
What is the InChIKey of [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate?
The InChIKey is UQOKRMXMNMGFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F2NO2S/c24-20-3-1-18(2-4-20)23(27)28-14-16-7-9-26(10-8-16)13-17-11-19-12-21(25)5-6-22(19)29-15-17/h1-6,12,16-17H,7-11,13-15H2.
What are the key properties of [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate?
[1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate has a molecular weight of 417.52 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6-fluoro-3,4-dihydro-2H-thiochromen-3-yl)methyl]piperidin-4-yl]methyl 4-fluorobenzoate is sourced from PubChem (CID 19982155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).