About 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride
1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride (PubChem CID 19982165) has the molecular formula C12H17ClFNS
and a molecular weight of 261.79 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride |
| PubChem CID | 19982165 |
| Molecular Formula | C12H17ClFNS |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)CC1CSc2c(F)cccc2C1.Cl |
| InChI | InChI=1S/C12H16FNS.ClH/c1-14(2)7-9-6-10-4-3-5-11(13)12(10)15-8-9;/h3-5,9H,6-8H2,1-2H3;1H |
| InChIKey | IMBIEBXHQIYHJS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride?
The IUPAC name of 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride (CID 19982165) is 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride.
What is the SMILES notation for 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride?
The canonical SMILES for 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride is CN(C)CC1CSc2c(F)cccc2C1.Cl.
What is the InChIKey of 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride?
The InChIKey is IMBIEBXHQIYHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNS.ClH/c1-14(2)7-9-6-10-4-3-5-11(13)12(10)15-8-9;/h3-5,9H,6-8H2,1-2H3;1H.
What are the key properties of 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride?
1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride has a molecular weight of 261.79 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-fluoro-3,4-dihydro-2H-thiochromen-3-yl)-N,N-dimethylmethanamine;hydrochloride is sourced from PubChem (CID 19982165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).