About 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine
5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 19982208) has the molecular formula C21H23N5O2S
and a molecular weight of 409.52 g/mol. Its IUPAC name is 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 19982208 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(CCN2CCN(c3ccccc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C21H23N5O2S/c22-21-23-20(16-6-2-1-3-7-16)19(29-21)10-11-24-12-14-25(15-13-24)17-8-4-5-9-18(17)26(27)28/h1-9H,10-15H2,(H2,22,23) |
| InChIKey | SHNFBPJYGLIGQV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine (CID 19982208) is 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine is Nc1nc(-c2ccccc2)c(CCN2CCN(c3ccccc3[N+](=O)[O-])CC2)s1.
What is the InChIKey of 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine?
The InChIKey is SHNFBPJYGLIGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O2S/c22-21-23-20(16-6-2-1-3-7-16)19(29-21)10-11-24-12-14-25(15-13-24)17-8-4-5-9-18(17)26(27)28/h1-9H,10-15H2,(H2,22,23).
What are the key properties of 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine?
5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine has a molecular weight of 409.52 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]-4-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 19982208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).