About 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one
3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one (PubChem CID 19982531) has the molecular formula C7H10BrNO2
and a molecular weight of 220.07 g/mol. Its IUPAC name is 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one |
| PubChem CID | 19982531 |
| Molecular Formula | C7H10BrNO2 |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one |
| SMILES | O=C1C=C(OCCCBr)CN1 |
| InChI | InChI=1S/C7H10BrNO2/c8-2-1-3-11-6-4-7(10)9-5-6/h4H,1-3,5H2,(H,9,10) |
| InChIKey | IQTIEYKVVDWYAP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one (CID 19982531) is 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one is O=C1C=C(OCCCBr)CN1.
What is the InChIKey of 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one?
The InChIKey is IQTIEYKVVDWYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrNO2/c8-2-1-3-11-6-4-7(10)9-5-6/h4H,1-3,5H2,(H,9,10).
What are the key properties of 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one?
3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one has a molecular weight of 220.07 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromopropoxy)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 19982531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).