About 3-octoxy-1,2-dihydropyrrol-5-one
3-octoxy-1,2-dihydropyrrol-5-one (PubChem CID 19982578) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-octoxy-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-octoxy-1,2-dihydropyrrol-5-one |
| PubChem CID | 19982578 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-octoxy-1,2-dihydropyrrol-5-one |
| SMILES | CCCCCCCCOC1=CC(=O)NC1 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-8-15-11-9-12(14)13-10-11/h9H,2-8,10H2,1H3,(H,13,14) |
| InChIKey | ZABBKXMFPDQEHH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octoxy-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octoxy-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-octoxy-1,2-dihydropyrrol-5-one (CID 19982578) is 3-octoxy-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-octoxy-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-octoxy-1,2-dihydropyrrol-5-one is CCCCCCCCOC1=CC(=O)NC1.
What is the InChIKey of 3-octoxy-1,2-dihydropyrrol-5-one?
The InChIKey is ZABBKXMFPDQEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-8-15-11-9-12(14)13-10-11/h9H,2-8,10H2,1H3,(H,13,14).
What are the key properties of 3-octoxy-1,2-dihydropyrrol-5-one?
3-octoxy-1,2-dihydropyrrol-5-one has a molecular weight of 211.30 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octoxy-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 19982578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).