About 3-propan-2-yloxy-1,2-dihydropyrrol-5-one
3-propan-2-yloxy-1,2-dihydropyrrol-5-one (PubChem CID 19982679) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-propan-2-yloxy-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-propan-2-yloxy-1,2-dihydropyrrol-5-one |
| PubChem CID | 19982679 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-propan-2-yloxy-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)OC1=CC(=O)NC1 |
| InChI | InChI=1S/C7H11NO2/c1-5(2)10-6-3-7(9)8-4-6/h3,5H,4H2,1-2H3,(H,8,9) |
| InChIKey | BTXQJKHZBGHBPG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yloxy-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxy-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-propan-2-yloxy-1,2-dihydropyrrol-5-one (CID 19982679) is 3-propan-2-yloxy-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-propan-2-yloxy-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-propan-2-yloxy-1,2-dihydropyrrol-5-one is CC(C)OC1=CC(=O)NC1.
What is the InChIKey of 3-propan-2-yloxy-1,2-dihydropyrrol-5-one?
The InChIKey is BTXQJKHZBGHBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-5(2)10-6-3-7(9)8-4-6/h3,5H,4H2,1-2H3,(H,8,9).
What are the key properties of 3-propan-2-yloxy-1,2-dihydropyrrol-5-one?
3-propan-2-yloxy-1,2-dihydropyrrol-5-one has a molecular weight of 141.17 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxy-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 19982679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).