About [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate
[(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate (PubChem CID 19982715) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate.
Molecular Properties
| Compound Name | [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate |
| PubChem CID | 19982715 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate |
| SMILES | CCC(/C=C1\C(C)=CC(=O)CC1(C)C)OC(C)=O |
| InChI | InChI=1S/C15H22O3/c1-6-13(18-11(3)16)8-14-10(2)7-12(17)9-15(14,4)5/h7-8,13H,6,9H2,1-5H3/b14-8+ |
| InChIKey | KUTONPLBGHRGRP-RIYZIHGNSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate?
The IUPAC name of [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate (CID 19982715) is [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate.
What is the SMILES notation for [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate?
The canonical SMILES for [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate is CCC(/C=C1\C(C)=CC(=O)CC1(C)C)OC(C)=O.
What is the InChIKey of [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate?
The InChIKey is KUTONPLBGHRGRP-RIYZIHGNSA-N. The full InChI is InChI=1S/C15H22O3/c1-6-13(18-11(3)16)8-14-10(2)7-12(17)9-15(14,4)5/h7-8,13H,6,9H2,1-5H3/b14-8+.
What are the key properties of [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate?
[(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate has a molecular weight of 250.34 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl] acetate is sourced from PubChem (CID 19982715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).