C34H40O14 — CID 19982981
tert-butyl [1,5,8-tris[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-2-yl] carbonate (PubChem CID 19982981) has the molecular formula C34H40O14 and a molecular weight of 672.68 g/mol. Its IUPAC name is tert-butyl [1,5,8-tris[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-2-yl] carbonate.
| Compound Name | tert-butyl [1,5,8-tris[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-2-yl] carbonate |
|---|---|
| PubChem CID | 19982981 |
| Molecular Formula | C34H40O14 |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | tert-butyl [1,5,8-tris[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2c(c1OC(=O)OC(C)(C)C)C(=O)c1c(OC(=O)OC(C)(C)C)ccc(OC(=O)OC(C)(C)C)c1C2=O |
| InChI | InChI=1S/C34H40O14/c1-31(2,3)45-27(37)41-18-15-16-19(42-28(38)46-32(4,5)6)23-22(18)24(35)17-13-14-20(43-29(39)47-33(7,8)9)26(21(17)25(23)36)44-30(40)48-34(10,11)12/h13-16H,1-12H3 |
| InChIKey | POWGPWGNAVMEOQ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|