C43H66O6S — CID 19982997
3,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]oxiran-2-one;(2,2,6,6-tetramethylthian-4-yl) acetate (PubChem CID 19982997) has the molecular formula C43H66O6S and a molecular weight of 711.06 g/mol. Its IUPAC name is 3,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]oxiran-2-one;(2,2,6,6-tetramethylthian-4-yl) acetate.
| Compound Name | 3,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]oxiran-2-one;(2,2,6,6-tetramethylthian-4-yl) acetate |
|---|---|
| PubChem CID | 19982997 |
| Molecular Formula | C43H66O6S |
| Molecular Weight | 711.06 g/mol |
| Exact Mass | 710.46 |
| IUPAC Name | 3,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]oxiran-2-one;(2,2,6,6-tetramethylthian-4-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(C)SC(C)(C)C1.CC(C)(C)c1cc(CC2(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)OC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H46O4.C11H20O2S/c1-28(2,3)21-13-19(14-22(25(21)33)29(4,5)6)17-32(27(35)36-32)18-20-15-23(30(7,8)9)26(34)24(16-20)31(10,11)12;1-8(12)13-9-6-10(2,3)14-11(4,5)7-9/h13-16,33-34H,17-18H2,1-12H3;9H,6-7H2,1-5H3 |
| InChIKey | HNHBMKCDTZJKRN-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.06 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|