About 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol
2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol (PubChem CID 19983233) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol |
| PubChem CID | 19983233 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol |
| SMILES | NCCC1(O)CCc2ccccc2C12CCCC2 |
| InChI | InChI=1S/C16H23NO/c17-12-11-16(18)10-7-13-5-1-2-6-14(13)15(16)8-3-4-9-15/h1-2,5-6,18H,3-4,7-12,17H2 |
| InChIKey | OOYLLOONMCLOML-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol?
The IUPAC name of 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol (CID 19983233) is 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol.
What is the SMILES notation for 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol?
The canonical SMILES for 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol is NCCC1(O)CCc2ccccc2C12CCCC2.
What is the InChIKey of 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol?
The InChIKey is OOYLLOONMCLOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c17-12-11-16(18)10-7-13-5-1-2-6-14(13)15(16)8-3-4-9-15/h1-2,5-6,18H,3-4,7-12,17H2.
What are the key properties of 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol?
2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol has a molecular weight of 245.37 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)spiro[3,4-dihydronaphthalene-1,1'-cyclopentane]-2-ol is sourced from PubChem (CID 19983233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).