C12H14N2 — CID 19983261
4b,8a,9,9a-tetrahydro-4aH-carbazol-4-amine (PubChem CID 19983261) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-carbazol-4-amine.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-carbazol-4-amine |
|---|---|
| PubChem CID | 19983261 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-carbazol-4-amine |
| SMILES | NC1=CC=CC2NC3C=CC=CC3C12 |
| InChI | InChI=1S/C12H14N2/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-8,10-12,14H,13H2 |
| InChIKey | DQTUPRCBHPUERQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |