About chloroform;N,N-dimethylmethanamine
chloroform;N,N-dimethylmethanamine (PubChem CID 19983331) has the molecular formula C4H10Cl3N
and a molecular weight of 178.49 g/mol. Its IUPAC name is chloroform;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | chloroform;N,N-dimethylmethanamine |
| PubChem CID | 19983331 |
| Molecular Formula | C4H10Cl3N |
| Molecular Weight | 178.49 g/mol |
| Exact Mass | 176.99 |
| IUPAC Name | chloroform;N,N-dimethylmethanamine |
| SMILES | CN(C)C.ClC(Cl)Cl |
| InChI | InChI=1S/C3H9N.CHCl3/c1-4(2)3;2-1(3)4/h1-3H3;1H |
| InChIKey | LUEKTZMAXBKUJZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;N,N-dimethylmethanamine?
The IUPAC name of chloroform;N,N-dimethylmethanamine (CID 19983331) is chloroform;N,N-dimethylmethanamine.
What is the SMILES notation for chloroform;N,N-dimethylmethanamine?
The canonical SMILES for chloroform;N,N-dimethylmethanamine is CN(C)C.ClC(Cl)Cl.
What is the InChIKey of chloroform;N,N-dimethylmethanamine?
The InChIKey is LUEKTZMAXBKUJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CHCl3/c1-4(2)3;2-1(3)4/h1-3H3;1H.
What are the key properties of chloroform;N,N-dimethylmethanamine?
chloroform;N,N-dimethylmethanamine has a molecular weight of 178.49 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;N,N-dimethylmethanamine is sourced from PubChem (CID 19983331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).