About N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine
N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 19983568) has the molecular formula C6H8ClFN4
and a molecular weight of 190.61 g/mol. Its IUPAC name is N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 19983568 |
| Molecular Formula | C6H8ClFN4 |
| Molecular Weight | 190.61 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | NCCNc1ncnc(F)c1Cl |
| InChI | InChI=1S/C6H8ClFN4/c7-4-5(8)11-3-12-6(4)10-2-1-9/h3H,1-2,9H2,(H,10,11,12) |
| InChIKey | RMMXJXJUXBRVBA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.61 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine (CID 19983568) is N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine is NCCNc1ncnc(F)c1Cl.
What is the InChIKey of N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine?
The InChIKey is RMMXJXJUXBRVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClFN4/c7-4-5(8)11-3-12-6(4)10-2-1-9/h3H,1-2,9H2,(H,10,11,12).
What are the key properties of N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine?
N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine has a molecular weight of 190.61 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-6-fluoropyrimidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 19983568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).