About 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine
3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine (PubChem CID 19983587) has the molecular formula C16H10N4S2
and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine |
| PubChem CID | 19983587 |
| Molecular Formula | C16H10N4S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine |
| SMILES | c1ccc(-c2nnc(-c3cccs3)c(-c3cccs3)n2)nc1 |
| InChI | InChI=1S/C16H10N4S2/c1-2-8-17-11(5-1)16-18-14(12-6-3-9-21-12)15(19-20-16)13-7-4-10-22-13/h1-10H |
| InChIKey | RDXVVAYVWXXBPB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine?
The IUPAC name of 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine (CID 19983587) is 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine.
What is the SMILES notation for 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine?
The canonical SMILES for 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine is c1ccc(-c2nnc(-c3cccs3)c(-c3cccs3)n2)nc1.
What is the InChIKey of 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine?
The InChIKey is RDXVVAYVWXXBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4S2/c1-2-8-17-11(5-1)16-18-14(12-6-3-9-21-12)15(19-20-16)13-7-4-10-22-13/h1-10H.
What are the key properties of 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine?
3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine has a molecular weight of 322.42 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yl-5,6-dithiophen-2-yl-1,2,4-triazine is sourced from PubChem (CID 19983587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).