C26H24N2O2 — CID 19984854
2,5-bis[2-(4-propoxyphenyl)ethynyl]pyrimidine (PubChem CID 19984854) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2,5-bis[2-(4-propoxyphenyl)ethynyl]pyrimidine.
| Compound Name | 2,5-bis[2-(4-propoxyphenyl)ethynyl]pyrimidine |
|---|---|
| PubChem CID | 19984854 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2,5-bis[2-(4-propoxyphenyl)ethynyl]pyrimidine |
| SMILES | CCCOc1ccc(C#Cc2cnc(C#Cc3ccc(OCCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-3-17-29-24-12-7-21(8-13-24)5-6-23-19-27-26(28-20-23)16-11-22-9-14-25(15-10-22)30-18-4-2/h7-10,12-15,19-20H,3-4,17-18H2,1-2H3 |
| InChIKey | GYROLXLNFHYPOT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|