C24H51N — CID 19985237
2,6,8-trimethyl-N-(2,6,8-trimethylnonan-4-yl)nonan-4-amine (PubChem CID 19985237) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is 2,6,8-trimethyl-N-(2,6,8-trimethylnonan-4-yl)nonan-4-amine.
| Compound Name | 2,6,8-trimethyl-N-(2,6,8-trimethylnonan-4-yl)nonan-4-amine |
|---|---|
| PubChem CID | 19985237 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | 2,6,8-trimethyl-N-(2,6,8-trimethylnonan-4-yl)nonan-4-amine |
| SMILES | CC(C)CC(C)CC(CC(C)C)NC(CC(C)C)CC(C)CC(C)C |
| InChI | InChI=1S/C24H51N/c1-17(2)11-21(9)15-23(13-19(5)6)25-24(14-20(7)8)16-22(10)12-18(3)4/h17-25H,11-16H2,1-10H3 |
| InChIKey | FXZVACQCUNWYEK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |