About 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane
3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane (PubChem CID 19985310) has the molecular formula C12H25ClO2
and a molecular weight of 236.78 g/mol. Its IUPAC name is 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane |
| PubChem CID | 19985310 |
| Molecular Formula | C12H25ClO2 |
| Molecular Weight | 236.78 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane |
| SMILES | COCC(CC(C)C)(C(C)C)C(Cl)OC |
| InChI | InChI=1S/C12H25ClO2/c1-9(2)7-12(8-14-5,10(3)4)11(13)15-6/h9-11H,7-8H2,1-6H3 |
| InChIKey | DHUYHRODRPUAGN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane?
The IUPAC name of 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane (CID 19985310) is 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane.
What is the SMILES notation for 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane?
The canonical SMILES for 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane is COCC(CC(C)C)(C(C)C)C(Cl)OC.
What is the InChIKey of 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane?
The InChIKey is DHUYHRODRPUAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25ClO2/c1-9(2)7-12(8-14-5,10(3)4)11(13)15-6/h9-11H,7-8H2,1-6H3.
What are the key properties of 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane?
3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane has a molecular weight of 236.78 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(methoxy)methyl]-3-(methoxymethyl)-2,5-dimethylhexane is sourced from PubChem (CID 19985310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).