About 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene
5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene (PubChem CID 19985322) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene |
| PubChem CID | 19985322 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene |
| SMILES | COCC(CC=C(C)C)(COC)CC(C)C |
| InChI | InChI=1S/C14H28O2/c1-12(2)7-8-14(10-15-5,11-16-6)9-13(3)4/h7,13H,8-11H2,1-6H3 |
| InChIKey | STQGBLXWAUVWBU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene?
The IUPAC name of 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene (CID 19985322) is 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene.
What is the SMILES notation for 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene?
The canonical SMILES for 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene is COCC(CC=C(C)C)(COC)CC(C)C.
What is the InChIKey of 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene?
The InChIKey is STQGBLXWAUVWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-12(2)7-8-14(10-15-5,11-16-6)9-13(3)4/h7,13H,8-11H2,1-6H3.
What are the key properties of 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene?
5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene has a molecular weight of 228.38 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(methoxymethyl)-2,7-dimethyloct-2-ene is sourced from PubChem (CID 19985322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).