About (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene
(E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene (PubChem CID 19985333) has the molecular formula C11H21ClO2
and a molecular weight of 220.74 g/mol. Its IUPAC name is (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene.
Molecular Properties
| Compound Name | (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene |
| PubChem CID | 19985333 |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene |
| SMILES | COCC(C/C=C/Cl)(COC)C(C)C |
| InChI | InChI=1S/C11H21ClO2/c1-10(2)11(8-13-3,9-14-4)6-5-7-12/h5,7,10H,6,8-9H2,1-4H3/b7-5+ |
| InChIKey | XLNZPDLKSHHSBS-FNORWQNLSA-N |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene?
The IUPAC name of (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene (CID 19985333) is (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene.
What is the SMILES notation for (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene?
The canonical SMILES for (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene is COCC(C/C=C/Cl)(COC)C(C)C.
What is the InChIKey of (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene?
The InChIKey is XLNZPDLKSHHSBS-FNORWQNLSA-N. The full InChI is InChI=1S/C11H21ClO2/c1-10(2)11(8-13-3,9-14-4)6-5-7-12/h5,7,10H,6,8-9H2,1-4H3/b7-5+.
What are the key properties of (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene?
(E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene has a molecular weight of 220.74 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-chloro-4,4-bis(methoxymethyl)-5-methylhex-1-ene is sourced from PubChem (CID 19985333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).