About 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane
3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane (PubChem CID 19985344) has the molecular formula C11H23BrO2
and a molecular weight of 267.21 g/mol. Its IUPAC name is 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane.
Molecular Properties
| Compound Name | 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane |
| PubChem CID | 19985344 |
| Molecular Formula | C11H23BrO2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane |
| SMILES | COCC(C)(COC)C(Br)C(C)(C)C |
| InChI | InChI=1S/C11H23BrO2/c1-10(2,3)9(12)11(4,7-13-5)8-14-6/h9H,7-8H2,1-6H3 |
| InChIKey | NFALQOXWGWBXKM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane?
The IUPAC name of 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane (CID 19985344) is 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane.
What is the SMILES notation for 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane?
The canonical SMILES for 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane is COCC(C)(COC)C(Br)C(C)(C)C.
What is the InChIKey of 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane?
The InChIKey is NFALQOXWGWBXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23BrO2/c1-10(2,3)9(12)11(4,7-13-5)8-14-6/h9H,7-8H2,1-6H3.
What are the key properties of 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane?
3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane has a molecular weight of 267.21 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-methoxy-2-(methoxymethyl)-2,4,4-trimethylpentane is sourced from PubChem (CID 19985344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).