About (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene
(E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene (PubChem CID 19985347) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene.
Molecular Properties
| Compound Name | (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene |
| PubChem CID | 19985347 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene |
| SMILES | CC/C(C)=C/CC(COC)(COC)CC(C)C |
| InChI | InChI=1S/C15H30O2/c1-7-14(4)8-9-15(11-16-5,12-17-6)10-13(2)3/h8,13H,7,9-12H2,1-6H3/b14-8+ |
| InChIKey | SMWOHIVBVYXSTD-RIYZIHGNSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene?
The IUPAC name of (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene (CID 19985347) is (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene.
What is the SMILES notation for (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene?
The canonical SMILES for (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene is CC/C(C)=C/CC(COC)(COC)CC(C)C.
What is the InChIKey of (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene?
The InChIKey is SMWOHIVBVYXSTD-RIYZIHGNSA-N. The full InChI is InChI=1S/C15H30O2/c1-7-14(4)8-9-15(11-16-5,12-17-6)10-13(2)3/h8,13H,7,9-12H2,1-6H3/b14-8+.
What are the key properties of (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene?
(E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene has a molecular weight of 242.40 g/mol, XLogP of 4.06, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-bis(methoxymethyl)-3,8-dimethylnon-3-ene is sourced from PubChem (CID 19985347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).