About (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene
(E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene (PubChem CID 19985393) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene.
Molecular Properties
| Compound Name | (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene |
| PubChem CID | 19985393 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene |
| SMILES | C/C=C/CC(CCC(C)C)(COC)COC |
| InChI | InChI=1S/C14H28O2/c1-6-7-9-14(11-15-4,12-16-5)10-8-13(2)3/h6-7,13H,8-12H2,1-5H3/b7-6+ |
| InChIKey | JKZUPYLLIBBVDS-VOTSOKGWSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene?
The IUPAC name of (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene (CID 19985393) is (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene.
What is the SMILES notation for (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene?
The canonical SMILES for (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene is C/C=C/CC(CCC(C)C)(COC)COC.
What is the InChIKey of (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene?
The InChIKey is JKZUPYLLIBBVDS-VOTSOKGWSA-N. The full InChI is InChI=1S/C14H28O2/c1-6-7-9-14(11-15-4,12-16-5)10-8-13(2)3/h6-7,13H,8-12H2,1-5H3/b7-6+.
What are the key properties of (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene?
(E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene has a molecular weight of 228.38 g/mol, XLogP of 3.67, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-bis(methoxymethyl)-8-methylnon-2-ene is sourced from PubChem (CID 19985393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).