C28H16F10O4S — CID 19987055
1-(1,1,2,2,2-pentafluoroethyl)-3-[4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]phenyl]sulfonylphenoxy]benzene (PubChem CID 19987055) has the molecular formula C28H16F10O4S and a molecular weight of 638.48 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-3-[4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]phenyl]sulfonylphenoxy]benzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-3-[4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]phenyl]sulfonylphenoxy]benzene |
|---|---|
| PubChem CID | 19987055 |
| Molecular Formula | C28H16F10O4S |
| Molecular Weight | 638.48 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-3-[4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]phenyl]sulfonylphenoxy]benzene |
| SMILES | O=S(=O)(c1ccc(Oc2cccc(C(F)(F)C(F)(F)F)c2)cc1)c1ccc(Oc2cccc(C(F)(F)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H16F10O4S/c29-25(30,27(33,34)35)17-3-1-5-21(15-17)41-19-7-11-23(12-8-19)43(39,40)24-13-9-20(10-14-24)42-22-6-2-4-18(16-22)26(31,32)28(36,37)38/h1-16H |
| InChIKey | OHPRGPVTLCBPFI-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.48 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|