About 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one
3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 19987379) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 19987379 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1Cc1cocn1 |
| InChI | InChI=1S/C8H10N2O3/c1-10-7(4-13-8(10)11)2-6-3-12-5-9-6/h3,5,7H,2,4H2,1H3 |
| InChIKey | RYPPJHOWZIFZCL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one (CID 19987379) is 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one is CN1C(=O)OCC1Cc1cocn1.
What is the InChIKey of 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one?
The InChIKey is RYPPJHOWZIFZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-10-7(4-13-8(10)11)2-6-3-12-5-9-6/h3,5,7H,2,4H2,1H3.
What are the key properties of 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one?
3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one has a molecular weight of 182.18 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1,3-oxazol-4-ylmethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 19987379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).