C15H26N2O — CID 19987411
1,3-diethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]pyrrolidin-2-one (PubChem CID 19987411) has the molecular formula C15H26N2O and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,3-diethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]pyrrolidin-2-one.
| Compound Name | 1,3-diethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 19987411 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1,3-diethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]pyrrolidin-2-one |
| SMILES | CCC1C(CN(C1=O)CC)CC2=CCCN(C2)C |
| InChI | InChI=1S/C15H26N2O/c1-4-14-13(11-17(5-2)15(14)18)9-12-7-6-8-16(3)10-12/h7,13-14H,4-6,8-11H2,1-3H3 |
| InChIKey | QYQLJHVTXHDZDV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 23.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 337 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|