About 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one
3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one (PubChem CID 19987454) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 19987454 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one |
| SMILES | CCC1C(=O)NCC1Cc1cscn1 |
| InChI | InChI=1S/C10H14N2OS/c1-2-9-7(4-11-10(9)13)3-8-5-14-6-12-8/h5-7,9H,2-4H2,1H3,(H,11,13) |
| InChIKey | JSMAQDYCLWIHPR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one (CID 19987454) is 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one is CCC1C(=O)NCC1Cc1cscn1.
What is the InChIKey of 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one?
The InChIKey is JSMAQDYCLWIHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-2-9-7(4-11-10(9)13)3-8-5-14-6-12-8/h5-7,9H,2-4H2,1H3,(H,11,13).
What are the key properties of 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one?
3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one has a molecular weight of 210.30 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 19987454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).