About 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one
2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one (PubChem CID 19987495) has the molecular formula C8H11N3O2
and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one |
| PubChem CID | 19987495 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one |
| SMILES | Cn1cnc(CN2OCCC2=O)c1 |
| InChI | InChI=1S/C8H11N3O2/c1-10-4-7(9-6-10)5-11-8(12)2-3-13-11/h4,6H,2-3,5H2,1H3 |
| InChIKey | AIECYJWHIWWDOD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one?
The IUPAC name of 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one (CID 19987495) is 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one.
What is the SMILES notation for 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one?
The canonical SMILES for 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one is Cn1cnc(CN2OCCC2=O)c1.
What is the InChIKey of 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one?
The InChIKey is AIECYJWHIWWDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-10-4-7(9-6-10)5-11-8(12)2-3-13-11/h4,6H,2-3,5H2,1H3.
What are the key properties of 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one?
2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one has a molecular weight of 181.20 g/mol, XLogP of 0.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methylimidazol-4-yl)methyl]-1,2-oxazolidin-3-one is sourced from PubChem (CID 19987495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).