About 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one
4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one (PubChem CID 19987510) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one |
| PubChem CID | 19987510 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one |
| SMILES | CC1(C)CON(Cc2ccccn2)C1=O |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)8-15-13(10(11)14)7-9-5-3-4-6-12-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | GVWLKCYPWOKPNV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one?
The IUPAC name of 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one (CID 19987510) is 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one.
What is the SMILES notation for 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one?
The canonical SMILES for 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one is CC1(C)CON(Cc2ccccn2)C1=O.
What is the InChIKey of 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one?
The InChIKey is GVWLKCYPWOKPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-11(2)8-15-13(10(11)14)7-9-5-3-4-6-12-9/h3-6H,7-8H2,1-2H3.
What are the key properties of 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one?
4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one has a molecular weight of 206.24 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(pyridin-2-ylmethyl)-1,2-oxazolidin-3-one is sourced from PubChem (CID 19987510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).