About 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride
5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (PubChem CID 19988932) has the molecular formula C22H23ClN2O2
and a molecular weight of 382.89 g/mol. Its IUPAC name is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| PubChem CID | 19988932 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| SMILES | Cc1cc(C)n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)n1.Cl |
| InChI | InChI=1S/C22H22N2O2.ClH/c1-16-13-17(2)24(23-16)15-20-14-22(21(25)26-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-13,20H,14-15H2,1-2H3;1H |
| InChIKey | XGORVQGEXYJFRH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The IUPAC name of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (CID 19988932) is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
What is the SMILES notation for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The canonical SMILES for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is Cc1cc(C)n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)n1.Cl.
What is the InChIKey of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The InChIKey is XGORVQGEXYJFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2.ClH/c1-16-13-17(2)24(23-16)15-20-14-22(21(25)26-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-13,20H,14-15H2,1-2H3;1H.
What are the key properties of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride has a molecular weight of 382.89 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is sourced from PubChem (CID 19988932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).