C16H19NO2 — CID 19988978
4-(3-cyclopent-2-en-1-yl-4-methoxyphenyl)pyrrolidin-2-one (PubChem CID 19988978) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(3-cyclopent-2-en-1-yl-4-methoxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-(3-cyclopent-2-en-1-yl-4-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 19988978 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(3-cyclopent-2-en-1-yl-4-methoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc(C2CNC(=O)C2)cc1C1C=CCC1 |
| InChI | InChI=1S/C16H19NO2/c1-19-15-7-6-12(13-9-16(18)17-10-13)8-14(15)11-4-2-3-5-11/h2,4,6-8,11,13H,3,5,9-10H2,1H3,(H,17,18) |
| InChIKey | YWJTYGYSPVWUJQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|