C18H34N2O3 — CID 19989070
2-hexyl-8-hydroxy-2,7,7,9,9-pentamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 19989070) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-hexyl-8-hydroxy-2,7,7,9,9-pentamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 2-hexyl-8-hydroxy-2,7,7,9,9-pentamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 19989070 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 2-hexyl-8-hydroxy-2,7,7,9,9-pentamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | CCCCCCC1(C)NC(=O)C2(CC(C)(C)N(O)C(C)(C)C2)O1 |
| InChI | InChI=1S/C18H34N2O3/c1-7-8-9-10-11-17(6)19-14(21)18(23-17)12-15(2,3)20(22)16(4,5)13-18/h22H,7-13H2,1-6H3,(H,19,21) |
| InChIKey | CGJXIZWERINZPA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|