C8H9ClN4O3S — CID 19989223
ethyl 7-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonate (PubChem CID 19989223) has the molecular formula C8H9ClN4O3S and a molecular weight of 276.71 g/mol. Its IUPAC name is ethyl 7-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonate.
| Compound Name | ethyl 7-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonate |
|---|---|
| PubChem CID | 19989223 |
| Molecular Formula | C8H9ClN4O3S |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | ethyl 7-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonate |
| SMILES | CCOS(=O)(=O)c1nc2nc(C)cc(Cl)n2n1 |
| InChI | InChI=1S/C8H9ClN4O3S/c1-3-16-17(14,15)8-11-7-10-5(2)4-6(9)13(7)12-8/h4H,3H2,1-2H3 |
| InChIKey | ROFCWYZEAOEFAL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|