About N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine
N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine (PubChem CID 19989276) has the molecular formula C27H54N4O3
and a molecular weight of 482.75 g/mol. Its IUPAC name is N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine |
| PubChem CID | 19989276 |
| Molecular Formula | C27H54N4O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.42 |
| IUPAC Name | N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine |
| SMILES | CCC1CN(CCN(CCN2CCOC(C)C2)CCN2CC(CC)OC(CC)C2)CC(CC)O1 |
| InChI | InChI=1S/C27H54N4O3/c1-6-24-19-30(20-25(7-2)33-24)14-11-28(10-13-29-16-17-32-23(5)18-29)12-15-31-21-26(8-3)34-27(9-4)22-31/h23-27H,6-22H2,1-5H3 |
| InChIKey | ILRTZWVZPGTRTQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine?
The IUPAC name of N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine (CID 19989276) is N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine.
What is the SMILES notation for N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine?
The canonical SMILES for N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine is CCC1CN(CCN(CCN2CCOC(C)C2)CCN2CC(CC)OC(CC)C2)CC(CC)O1.
What is the InChIKey of N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine?
The InChIKey is ILRTZWVZPGTRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H54N4O3/c1-6-24-19-30(20-25(7-2)33-24)14-11-28(10-13-29-16-17-32-23(5)18-29)12-15-31-21-26(8-3)34-27(9-4)22-31/h23-27H,6-22H2,1-5H3.
What are the key properties of N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine?
N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine has a molecular weight of 482.75 g/mol, XLogP of 2.79, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[2-(2,6-diethylmorpholin-4-yl)ethyl]-2-(2-methylmorpholin-4-yl)ethanamine is sourced from PubChem (CID 19989276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).